C22H16F2N4O — CID 71812409
1-(3,4-difluorophenyl)-3-(1,3-diphenylpyrazol-5-yl)urea (PubChem CID 71812409) has the molecular formula C22H16F2N4O and a molecular weight of 390.39 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(1,3-diphenylpyrazol-5-yl)urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-(1,3-diphenylpyrazol-5-yl)urea |
|---|---|
| PubChem CID | 71812409 |
| Molecular Formula | C22H16F2N4O |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(1,3-diphenylpyrazol-5-yl)urea |
| SMILES | O=C(Nc1ccc(F)c(F)c1)Nc1cc(-c2ccccc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C22H16F2N4O/c23-18-12-11-16(13-19(18)24)25-22(29)26-21-14-20(15-7-3-1-4-8-15)27-28(21)17-9-5-2-6-10-17/h1-14H,(H2,25,26,29) |
| InChIKey | QTXPHCHEMGIMJO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |