C25H21ClN4O3 — CID 58011087
ethyl 4-[5-[(4-chlorophenyl)carbamoylamino]-3-phenylpyrazol-1-yl]benzoate (PubChem CID 58011087) has the molecular formula C25H21ClN4O3 and a molecular weight of 460.92 g/mol. Its IUPAC name is ethyl 4-[5-[(4-chlorophenyl)carbamoylamino]-3-phenylpyrazol-1-yl]benzoate.
| Compound Name | ethyl 4-[5-[(4-chlorophenyl)carbamoylamino]-3-phenylpyrazol-1-yl]benzoate |
|---|---|
| PubChem CID | 58011087 |
| Molecular Formula | C25H21ClN4O3 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | ethyl 4-[5-[(4-chlorophenyl)carbamoylamino]-3-phenylpyrazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-n2nc(-c3ccccc3)cc2NC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H21ClN4O3/c1-2-33-24(31)18-8-14-21(15-9-18)30-23(16-22(29-30)17-6-4-3-5-7-17)28-25(32)27-20-12-10-19(26)11-13-20/h3-16H,2H2,1H3,(H2,27,28,32) |
| InChIKey | HKLRABCBYKFCPO-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |