C24H19ClN4O3 — CID 16522577
[2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate (PubChem CID 16522577) has the molecular formula C24H19ClN4O3 and a molecular weight of 446.89 g/mol. Its IUPAC name is [2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate.
| Compound Name | [2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 16522577 |
| Molecular Formula | C24H19ClN4O3 |
| Molecular Weight | 446.89 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] 6-chloropyridine-3-carboxylate |
| SMILES | Cc1ccc(-c2cc(NC(=O)COC(=O)c3ccc(Cl)nc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H19ClN4O3/c1-16-7-9-17(10-8-16)20-13-22(29(28-20)19-5-3-2-4-6-19)27-23(30)15-32-24(31)18-11-12-21(25)26-14-18/h2-14H,15H2,1H3,(H,27,30) |
| InChIKey | FYDIULJOKGZEPI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.89 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|