C23H19N5O3 — CID 7985543
[2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate (PubChem CID 7985543) has the molecular formula C23H19N5O3 and a molecular weight of 413.44 g/mol. Its IUPAC name is [2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate.
| Compound Name | [2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7985543 |
| Molecular Formula | C23H19N5O3 |
| Molecular Weight | 413.44 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-[[3-(4-methylphenyl)-1-phenylpyrazol-5-yl]amino]-2-oxoethyl] pyrazine-2-carboxylate |
| SMILES | Cc1ccc(-c2cc(NC(=O)COC(=O)c3cnccn3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H19N5O3/c1-16-7-9-17(10-8-16)19-13-21(28(27-19)18-5-3-2-4-6-18)26-22(29)15-31-23(30)20-14-24-11-12-25-20/h2-14H,15H2,1H3,(H,26,29) |
| InChIKey | JSZBQCBQOBMXBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |