C22H23N3O3 — CID 7694346
[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 4-propan-2-ylbenzoate (PubChem CID 7694346) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 4-propan-2-ylbenzoate.
| Compound Name | [2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 4-propan-2-ylbenzoate |
|---|---|
| PubChem CID | 7694346 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl] 4-propan-2-ylbenzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2ccc(C(C)C)cc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H23N3O3/c1-15(2)17-9-11-18(12-10-17)22(27)28-14-21(26)23-20-13-16(3)24-25(20)19-7-5-4-6-8-19/h4-13,15H,14H2,1-3H3,(H,23,26) |
| InChIKey | MVOPTGPEOLLZEU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |