C22H15F2N3O — CID 11383259
N-(1,3-diphenylpyrazol-5-yl)-2,5-difluorobenzamide (PubChem CID 11383259) has the molecular formula C22H15F2N3O and a molecular weight of 375.38 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-2,5-difluorobenzamide.
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 11383259 |
| Molecular Formula | C22H15F2N3O |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-2,5-difluorobenzamide |
| SMILES | O=C(Nc1cc(-c2ccccc2)nn1-c1ccccc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C22H15F2N3O/c23-16-11-12-19(24)18(13-16)22(28)25-21-14-20(15-7-3-1-4-8-15)26-27(21)17-9-5-2-6-10-17/h1-14H,(H,25,28) |
| InChIKey | MEBNWLGWUITDQR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |