C20H16N4OS — CID 11473880
N-(1,3-diphenylpyrazol-5-yl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 11473880) has the molecular formula C20H16N4OS and a molecular weight of 360.44 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 11473880 |
| Molecular Formula | C20H16N4OS |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2cc(-c3ccccc3)nn2-c2ccccc2)cs1 |
| InChI | InChI=1S/C20H16N4OS/c1-14-21-18(13-26-14)20(25)22-19-12-17(15-8-4-2-5-9-15)23-24(19)16-10-6-3-7-11-16/h2-13H,1H3,(H,22,25) |
| InChIKey | MGHUSSVEEFMYET-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |