C22H15N3OS2 — CID 11223352
N-(1,3-diphenylpyrazol-5-yl)thieno[2,3-b]thiophene-5-carboxamide (PubChem CID 11223352) has the molecular formula C22H15N3OS2 and a molecular weight of 401.52 g/mol. Its IUPAC name is N-(1,3-diphenylpyrazol-5-yl)thieno[2,3-b]thiophene-5-carboxamide.
| Compound Name | N-(1,3-diphenylpyrazol-5-yl)thieno[2,3-b]thiophene-5-carboxamide |
|---|---|
| PubChem CID | 11223352 |
| Molecular Formula | C22H15N3OS2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-(1,3-diphenylpyrazol-5-yl)thieno[2,3-b]thiophene-5-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccccc2)nn1-c1ccccc1)c1cc2ccsc2s1 |
| InChI | InChI=1S/C22H15N3OS2/c26-21(19-13-16-11-12-27-22(16)28-19)23-20-14-18(15-7-3-1-4-8-15)24-25(20)17-9-5-2-6-10-17/h1-14H,(H,23,26) |
| InChIKey | IKLHHFDCLXWALF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |