C24H18N6O2S2 — CID 44824119
1-methyl-3-N,5-N-bis(4-phenyl-1,3-thiazol-2-yl)pyrazole-3,5-dicarboxamide (PubChem CID 44824119) has the molecular formula C24H18N6O2S2 and a molecular weight of 486.58 g/mol. Its IUPAC name is 1-methyl-3-N,5-N-bis(4-phenyl-1,3-thiazol-2-yl)pyrazole-3,5-dicarboxamide.
| Compound Name | 1-methyl-3-N,5-N-bis(4-phenyl-1,3-thiazol-2-yl)pyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 44824119 |
| Molecular Formula | C24H18N6O2S2 |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 1-methyl-3-N,5-N-bis(4-phenyl-1,3-thiazol-2-yl)pyrazole-3,5-dicarboxamide |
| SMILES | Cn1nc(C(=O)Nc2nc(-c3ccccc3)cs2)cc1C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C24H18N6O2S2/c1-30-20(22(32)28-24-26-19(14-34-24)16-10-6-3-7-11-16)12-17(29-30)21(31)27-23-25-18(13-33-23)15-8-4-2-5-9-15/h2-14H,1H3,(H,25,27,31)(H,26,28,32) |
| InChIKey | ITTFAPQDKHPTOM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |