C18H15F3N4O — CID 56844199
1-(5-methyl-2-phenylpyrazol-3-yl)-3-[4-(trifluoromethyl)phenyl]urea (PubChem CID 56844199) has the molecular formula C18H15F3N4O and a molecular weight of 360.34 g/mol. Its IUPAC name is 1-(5-methyl-2-phenylpyrazol-3-yl)-3-[4-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(5-methyl-2-phenylpyrazol-3-yl)-3-[4-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 56844199 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-(5-methyl-2-phenylpyrazol-3-yl)-3-[4-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(C(F)(F)F)cc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H15F3N4O/c1-12-11-16(25(24-12)15-5-3-2-4-6-15)23-17(26)22-14-9-7-13(8-10-14)18(19,20)21/h2-11H,1H3,(H2,22,23,26) |
| InChIKey | SJTNZNYNIAKMQP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |