C16H23N4O+ — CID 6932117
diethyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]azanium (PubChem CID 6932117) has the molecular formula C16H23N4O+ and a molecular weight of 287.39 g/mol. Its IUPAC name is diethyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]azanium.
| Compound Name | diethyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 6932117 |
| Molecular Formula | C16H23N4O+ |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | diethyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]azanium |
| SMILES | CC[NH+](CC)CC(=O)Nc1cc(C)nn1-c1ccccc1 |
| InChI | InChI=1S/C16H22N4O/c1-4-19(5-2)12-16(21)17-15-11-13(3)18-20(15)14-9-7-6-8-10-14/h6-11H,4-5,12H2,1-3H3,(H,17,21)/p+1 |
| InChIKey | WOZVBVYHMNHTLR-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |