C24H30N5O2+ — CID 9295216
methyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]-[(4-morpholin-4-ylphenyl)methyl]azanium (PubChem CID 9295216) has the molecular formula C24H30N5O2+ and a molecular weight of 420.54 g/mol. Its IUPAC name is methyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]-[(4-morpholin-4-ylphenyl)methyl]azanium.
| Compound Name | methyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]-[(4-morpholin-4-ylphenyl)methyl]azanium |
|---|---|
| PubChem CID | 9295216 |
| Molecular Formula | C24H30N5O2+ |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | methyl-[2-[(5-methyl-2-phenylpyrazol-3-yl)amino]-2-oxoethyl]-[(4-morpholin-4-ylphenyl)methyl]azanium |
| SMILES | Cc1cc(NC(=O)C[NH+](C)Cc2ccc(N3CCOCC3)cc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H29N5O2/c1-19-16-23(29(26-19)22-6-4-3-5-7-22)25-24(30)18-27(2)17-20-8-10-21(11-9-20)28-12-14-31-15-13-28/h3-11,16H,12-15,17-18H2,1-2H3,(H,25,30)/p+1 |
| InChIKey | VXQSVIOFOKVKNT-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|