C22H26N5O3+ — CID 8592773
methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azanium (PubChem CID 8592773) has the molecular formula C22H26N5O3+ and a molecular weight of 408.48 g/mol. Its IUPAC name is methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azanium.
| Compound Name | methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azanium |
|---|---|
| PubChem CID | 8592773 |
| Molecular Formula | C22H26N5O3+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(N2CCOCC2)cc1)Cc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C22H25N5O3/c1-26(16-21-24-22(25-30-21)17-5-3-2-4-6-17)15-20(28)23-18-7-9-19(10-8-18)27-11-13-29-14-12-27/h2-10H,11-16H2,1H3,(H,23,28)/p+1 |
| InChIKey | OJFALDALJNMSSA-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|