C24H33N4O3+ — CID 8592781
methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl]azanium (PubChem CID 8592781) has the molecular formula C24H33N4O3+ and a molecular weight of 425.55 g/mol. Its IUPAC name is methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl]azanium.
| Compound Name | methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 8592781 |
| Molecular Formula | C24H33N4O3+ |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-[2-oxo-2-[[(2S)-2-phenylpropyl]amino]ethyl]azanium |
| SMILES | C[C@H](CNC(=O)C[NH+](C)CC(=O)Nc1ccc(N2CCOCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N4O3/c1-19(20-6-4-3-5-7-20)16-25-23(29)17-27(2)18-24(30)26-21-8-10-22(11-9-21)28-12-14-31-15-13-28/h3-11,19H,12-18H2,1-2H3,(H,25,29)(H,26,30)/p+1/t19-/m1/s1 |
| InChIKey | BLORQEBIXDICLL-LJQANCHMSA-O |
| XLogP | 0.90 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|