C24H31N4O3+ — CID 8592833
methyl-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium (PubChem CID 8592833) has the molecular formula C24H31N4O3+ and a molecular weight of 423.54 g/mol. Its IUPAC name is methyl-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium.
| Compound Name | methyl-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8592833 |
| Molecular Formula | C24H31N4O3+ |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | methyl-[2-[(2S)-2-methyl-2,3-dihydroindol-1-yl]-2-oxoethyl]-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)C[NH+](C)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H30N4O3/c1-18-15-19-5-3-4-6-22(19)28(18)24(30)17-26(2)16-23(29)25-20-7-9-21(10-8-20)27-11-13-31-14-12-27/h3-10,18H,11-17H2,1-2H3,(H,25,29)/p+1/t18-/m0/s1 |
| InChIKey | CVAQEOPMYUCRGY-SFHVURJKSA-O |
| XLogP | 0.95 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|