C23H29N3O — CID 109010553
1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-(4-methylpiperidin-1-yl)anilino]ethanone (PubChem CID 109010553) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-(4-methylpiperidin-1-yl)anilino]ethanone.
| Compound Name | 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-(4-methylpiperidin-1-yl)anilino]ethanone |
|---|---|
| PubChem CID | 109010553 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 1-(2-methyl-2,3-dihydroindol-1-yl)-2-[4-(4-methylpiperidin-1-yl)anilino]ethanone |
| SMILES | CC1CCN(c2ccc(NCC(=O)N3c4ccccc4CC3C)cc2)CC1 |
| InChI | InChI=1S/C23H29N3O/c1-17-11-13-25(14-12-17)21-9-7-20(8-10-21)24-16-23(27)26-18(2)15-19-5-3-4-6-22(19)26/h3-10,17-18,24H,11-16H2,1-2H3 |
| InChIKey | AACKCRBBIYMOKT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|