C24H24N2O2 — CID 2339721
1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-phenylmethoxyanilino)ethanone (PubChem CID 2339721) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-phenylmethoxyanilino)ethanone.
| Compound Name | 1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-phenylmethoxyanilino)ethanone |
|---|---|
| PubChem CID | 2339721 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 1-[(2R)-2-methyl-2,3-dihydroindol-1-yl]-2-(4-phenylmethoxyanilino)ethanone |
| SMILES | C[C@@H]1Cc2ccccc2N1C(=O)CNc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-18-15-20-9-5-6-10-23(20)26(18)24(27)16-25-21-11-13-22(14-12-21)28-17-19-7-3-2-4-8-19/h2-14,18,25H,15-17H2,1H3/t18-/m1/s1 |
| InChIKey | UTMJHXIINHIKAV-GOSISDBHSA-N |
| XLogP | 4.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|