C23H26FN4O3+ — CID 9029424
[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium (PubChem CID 9029424) has the molecular formula C23H26FN4O3+ and a molecular weight of 425.48 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium.
| Compound Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9029424 |
| Molecular Formula | C23H26FN4O3+ |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl-methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(N2CCOCC2)cc1)Cc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C23H25FN4O3/c1-27(16-23-25-14-21(31-23)17-2-4-18(24)5-3-17)15-22(29)26-19-6-8-20(9-7-19)28-10-12-30-13-11-28/h2-9,14H,10-13,15-16H2,1H3,(H,26,29)/p+1 |
| InChIKey | FSLYLADQKPMDAF-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|