C15H16N2O3S — CID 155962659
3-methyl-5-oxo-5-[(5-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid (PubChem CID 155962659) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 3-methyl-5-oxo-5-[(5-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid.
| Compound Name | 3-methyl-5-oxo-5-[(5-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 155962659 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 3-methyl-5-oxo-5-[(5-phenyl-1,3-thiazol-2-yl)amino]pentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10(8-14(19)20)7-13(18)17-15-16-9-12(21-15)11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,19,20)(H,16,17,18) |
| InChIKey | WQJIWCRGMHCZKC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |