C17H21N3O3S — CID 86815396
ethyl 2-methyl-3-[(5-phenyl-1,3-thiazol-2-yl)carbamoylamino]butanoate (PubChem CID 86815396) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is ethyl 2-methyl-3-[(5-phenyl-1,3-thiazol-2-yl)carbamoylamino]butanoate.
| Compound Name | ethyl 2-methyl-3-[(5-phenyl-1,3-thiazol-2-yl)carbamoylamino]butanoate |
|---|---|
| PubChem CID | 86815396 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethyl 2-methyl-3-[(5-phenyl-1,3-thiazol-2-yl)carbamoylamino]butanoate |
| SMILES | CCOC(=O)C(C)C(C)NC(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C17H21N3O3S/c1-4-23-15(21)11(2)12(3)19-16(22)20-17-18-10-14(24-17)13-8-6-5-7-9-13/h5-12H,4H2,1-3H3,(H2,18,19,20,22) |
| InChIKey | PQKILNDSSCIVHA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |