C18H24N4OS — CID 78874563
1-(5-phenyl-1,3-thiazol-2-yl)-3-(1-piperidin-1-ylpropan-2-yl)urea (PubChem CID 78874563) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-(5-phenyl-1,3-thiazol-2-yl)-3-(1-piperidin-1-ylpropan-2-yl)urea.
| Compound Name | 1-(5-phenyl-1,3-thiazol-2-yl)-3-(1-piperidin-1-ylpropan-2-yl)urea |
|---|---|
| PubChem CID | 78874563 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-(5-phenyl-1,3-thiazol-2-yl)-3-(1-piperidin-1-ylpropan-2-yl)urea |
| SMILES | CC(CN1CCCCC1)NC(=O)Nc1ncc(-c2ccccc2)s1 |
| InChI | InChI=1S/C18H24N4OS/c1-14(13-22-10-6-3-7-11-22)20-17(23)21-18-19-12-16(24-18)15-8-4-2-5-9-15/h2,4-5,8-9,12,14H,3,6-7,10-11,13H2,1H3,(H2,19,20,21,23) |
| InChIKey | OGYHYSRVPUGEDP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |