C14H15N3O2S — CID 174188565
[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamic acid (PubChem CID 174188565) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is [5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamic acid.
| Compound Name | [5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174188565 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1ncc(-c2cccc(N3CCCC3)c2)s1 |
| InChI | InChI=1S/C14H15N3O2S/c18-14(19)16-13-15-9-12(20-13)10-4-3-5-11(8-10)17-6-1-2-7-17/h3-5,8-9H,1-2,6-7H2,(H,15,16)(H,18,19) |
| InChIKey | AUBGPIIKDCKQLN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |