C25H24FN3O4S — CID 163230166
[2-fluoro-6-formyl-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] butanoate (PubChem CID 163230166) has the molecular formula C25H24FN3O4S and a molecular weight of 481.55 g/mol. Its IUPAC name is [2-fluoro-6-formyl-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] butanoate.
| Compound Name | [2-fluoro-6-formyl-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] butanoate |
|---|---|
| PubChem CID | 163230166 |
| Molecular Formula | C25H24FN3O4S |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | [2-fluoro-6-formyl-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1c(F)cc(C(=O)Nc2ncc(-c3cccc(N4CCCC4)c3)s2)cc1C=O |
| InChI | InChI=1S/C25H24FN3O4S/c1-2-6-22(31)33-23-18(15-30)11-17(13-20(23)26)24(32)28-25-27-14-21(34-25)16-7-5-8-19(12-16)29-9-3-4-10-29/h5,7-8,11-15H,2-4,6,9-10H2,1H3,(H,27,28,32) |
| InChIKey | RQRSUYXAHAFEHU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|