C25H26FN3O6S — CID 170688041
[2-fluoro-6-methoxy-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] 3,4-dihydroxybutanoate (PubChem CID 170688041) has the molecular formula C25H26FN3O6S and a molecular weight of 515.56 g/mol. Its IUPAC name is [2-fluoro-6-methoxy-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] 3,4-dihydroxybutanoate.
| Compound Name | [2-fluoro-6-methoxy-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] 3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 170688041 |
| Molecular Formula | C25H26FN3O6S |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | [2-fluoro-6-methoxy-4-[[5-(3-pyrrolidin-1-ylphenyl)-1,3-thiazol-2-yl]carbamoyl]phenyl] 3,4-dihydroxybutanoate |
| SMILES | COc1cc(C(=O)Nc2ncc(-c3cccc(N4CCCC4)c3)s2)cc(F)c1OC(=O)CC(O)CO |
| InChI | InChI=1S/C25H26FN3O6S/c1-34-20-11-16(10-19(26)23(20)35-22(32)12-18(31)14-30)24(33)28-25-27-13-21(36-25)15-5-4-6-17(9-15)29-7-2-3-8-29/h4-6,9-11,13,18,30-31H,2-3,7-8,12,14H2,1H3,(H,27,28,33) |
| InChIKey | VGJKASGOFXIIGK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|