C15H16N4O2S — CID 94153836
(3R)-1-N-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1,3-dicarboxamide (PubChem CID 94153836) has the molecular formula C15H16N4O2S and a molecular weight of 316.39 g/mol. Its IUPAC name is (3R)-1-N-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 94153836 |
| Molecular Formula | C15H16N4O2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (3R)-1-N-(5-phenyl-1,3-thiazol-2-yl)pyrrolidine-1,3-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CCN(C(=O)Nc2ncc(-c3ccccc3)s2)C1 |
| InChI | InChI=1S/C15H16N4O2S/c16-13(20)11-6-7-19(9-11)15(21)18-14-17-8-12(22-14)10-4-2-1-3-5-10/h1-5,8,11H,6-7,9H2,(H2,16,20)(H,17,18,21)/t11-/m1/s1 |
| InChIKey | BZUIWFUHSMVJEU-LLVKDONJSA-N |
| XLogP | 2.15 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |