C19H21N5O3S — CID 95784454
4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide (PubChem CID 95784454) has the molecular formula C19H21N5O3S and a molecular weight of 399.48 g/mol. Its IUPAC name is 4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide.
| Compound Name | 4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95784454 |
| Molecular Formula | C19H21N5O3S |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]-N-(5-phenyl-1,3-thiazol-2-yl)piperidine-1-carboxamide |
| SMILES | C[C@]1(C2CCN(C(=O)Nc3ncc(-c4ccccc4)s3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H21N5O3S/c1-19(15(25)21-16(26)23-19)13-7-9-24(10-8-13)18(27)22-17-20-11-14(28-17)12-5-3-2-4-6-12/h2-6,11,13H,7-10H2,1H3,(H,20,22,27)(H2,21,23,25,26)/t19-/m1/s1 |
| InChIKey | XIWCGQSOALFRTI-LJQANCHMSA-N |
| XLogP | 2.65 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|