C20H26ClN5O4 — CID 95784456
N-(3-chloro-2-morpholin-4-ylphenyl)-4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidine-1-carboxamide (PubChem CID 95784456) has the molecular formula C20H26ClN5O4 and a molecular weight of 435.91 g/mol. Its IUPAC name is N-(3-chloro-2-morpholin-4-ylphenyl)-4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidine-1-carboxamide.
| Compound Name | N-(3-chloro-2-morpholin-4-ylphenyl)-4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 95784456 |
| Molecular Formula | C20H26ClN5O4 |
| Molecular Weight | 435.91 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-(3-chloro-2-morpholin-4-ylphenyl)-4-[(4R)-4-methyl-2,5-dioxoimidazolidin-4-yl]piperidine-1-carboxamide |
| SMILES | C[C@]1(C2CCN(C(=O)Nc3cccc(Cl)c3N3CCOCC3)CC2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H26ClN5O4/c1-20(17(27)23-18(28)24-20)13-5-7-26(8-6-13)19(29)22-15-4-2-3-14(21)16(15)25-9-11-30-12-10-25/h2-4,13H,5-12H2,1H3,(H,22,29)(H2,23,24,27,28)/t20-/m1/s1 |
| InChIKey | HTHPMRSXZNKWFS-HXUWFJFHSA-N |
| XLogP | 2.02 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.91 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|