C21H30ClN3O4 — CID 24614259
tert-butyl 4-[(3-chloro-2-morpholin-4-ylphenyl)carbamoyl]piperidine-1-carboxylate (PubChem CID 24614259) has the molecular formula C21H30ClN3O4 and a molecular weight of 423.94 g/mol. Its IUPAC name is tert-butyl 4-[(3-chloro-2-morpholin-4-ylphenyl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-chloro-2-morpholin-4-ylphenyl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24614259 |
| Molecular Formula | C21H30ClN3O4 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | tert-butyl 4-[(3-chloro-2-morpholin-4-ylphenyl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Nc2cccc(Cl)c2N2CCOCC2)CC1 |
| InChI | InChI=1S/C21H30ClN3O4/c1-21(2,3)29-20(27)25-9-7-15(8-10-25)19(26)23-17-6-4-5-16(22)18(17)24-11-13-28-14-12-24/h4-6,15H,7-14H2,1-3H3,(H,23,26) |
| InChIKey | KPUHPXWXCYYKQS-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |