C17H21ClN2O2 — CID 25347228
(1S)-N-(3-chloro-2-morpholin-4-ylphenyl)cyclohex-3-ene-1-carboxamide (PubChem CID 25347228) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is (1S)-N-(3-chloro-2-morpholin-4-ylphenyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-(3-chloro-2-morpholin-4-ylphenyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 25347228 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (1S)-N-(3-chloro-2-morpholin-4-ylphenyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1N1CCOCC1)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C17H21ClN2O2/c18-14-7-4-8-15(16(14)20-9-11-22-12-10-20)19-17(21)13-5-2-1-3-6-13/h1-2,4,7-8,13H,3,5-6,9-12H2,(H,19,21)/t13-/m1/s1 |
| InChIKey | RKIARDHHKXVJKJ-CYBMUJFWSA-N |
| XLogP | 3.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|