About tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate
tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 15952943) has the molecular formula C23H26Cl2N2O4
and a molecular weight of 465.38 g/mol. Its IUPAC name is tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate |
| PubChem CID | 15952943 |
| Molecular Formula | C23H26Cl2N2O4 |
| Molecular Weight | 465.38 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Nc2ccccc2Oc2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C23H26Cl2N2O4/c1-23(2,3)31-22(29)27-10-8-15(9-11-27)21(28)26-19-6-4-5-7-20(19)30-18-13-16(24)12-17(25)14-18/h4-7,12-15H,8-11H2,1-3H3,(H,26,28) |
| InChIKey | HJNBIFGNQNRKSD-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.38 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate (CID 15952943) is tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(C(=O)Nc2ccccc2Oc2cc(Cl)cc(Cl)c2)CC1.
What is the InChIKey of tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate?
The InChIKey is HJNBIFGNQNRKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26Cl2N2O4/c1-23(2,3)31-22(29)27-10-8-15(9-11-27)21(28)26-19-6-4-5-7-20(19)30-18-13-16(24)12-17(25)14-18/h4-7,12-15H,8-11H2,1-3H3,(H,26,28).
What are the key properties of tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate?
tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate has a molecular weight of 465.38 g/mol, XLogP of 6.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[2-(3,5-dichlorophenoxy)phenyl]carbamoyl]piperidine-1-carboxylate is sourced from PubChem (CID 15952943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).