C24H27F3N2O5 — CID 15952444
tert-butyl 4-[[2-[4-(trifluoromethoxy)phenoxy]phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 15952444) has the molecular formula C24H27F3N2O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is tert-butyl 4-[[2-[4-(trifluoromethoxy)phenoxy]phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[4-(trifluoromethoxy)phenoxy]phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 15952444 |
| Molecular Formula | C24H27F3N2O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | tert-butyl 4-[[2-[4-(trifluoromethoxy)phenoxy]phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Nc2ccccc2Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H27F3N2O5/c1-23(2,3)34-22(31)29-14-12-16(13-15-29)21(30)28-19-6-4-5-7-20(19)32-17-8-10-18(11-9-17)33-24(25,26)27/h4-11,16H,12-15H2,1-3H3,(H,28,30) |
| InChIKey | UKIPNVDDOBZVSG-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |