C18H17F3N2O4 — CID 35750813
1-(furan-3-carbonyl)-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide (PubChem CID 35750813) has the molecular formula C18H17F3N2O4 and a molecular weight of 382.34 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(furan-3-carbonyl)-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 35750813 |
| Molecular Formula | C18H17F3N2O4 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 1-(furan-3-carbonyl)-N-[2-(trifluoromethoxy)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1OC(F)(F)F)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C18H17F3N2O4/c19-18(20,21)27-15-4-2-1-3-14(15)22-16(24)12-5-8-23(9-6-12)17(25)13-7-10-26-11-13/h1-4,7,10-12H,5-6,8-9H2,(H,22,24) |
| InChIKey | YTFMKUBMBJGEFG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |