C20H22N2O5 — CID 35676238
methyl 3-[[1-(furan-3-carbonyl)piperidine-4-carbonyl]amino]-4-methylbenzoate (PubChem CID 35676238) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 3-[[1-(furan-3-carbonyl)piperidine-4-carbonyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[1-(furan-3-carbonyl)piperidine-4-carbonyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 35676238 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 3-[[1-(furan-3-carbonyl)piperidine-4-carbonyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)C2CCN(C(=O)c3ccoc3)CC2)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-13-3-4-15(20(25)26-2)11-17(13)21-18(23)14-5-8-22(9-6-14)19(24)16-7-10-27-12-16/h3-4,7,10-12,14H,5-6,8-9H2,1-2H3,(H,21,23) |
| InChIKey | KGNMBNMROXVIQT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |