C17H21F3N2O4 — CID 156743217
tert-butyl (3R)-3-[[3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 156743217) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156743217 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | tert-butyl (3R)-3-[[3-(trifluoromethoxy)phenyl]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C(=O)Nc2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H21F3N2O4/c1-16(2,3)26-15(24)22-8-7-11(10-22)14(23)21-12-5-4-6-13(9-12)25-17(18,19)20/h4-6,9,11H,7-8,10H2,1-3H3,(H,21,23)/t11-/m1/s1 |
| InChIKey | UGPGLQRGMPBCTP-LLVKDONJSA-N |
| XLogP | 3.78 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |