C17H21F3N2O3 — CID 51937786
(3S)-1-(2-methylpropanoyl)-N-[3-(trifluoromethoxy)phenyl]piperidine-3-carboxamide (PubChem CID 51937786) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is (3S)-1-(2-methylpropanoyl)-N-[3-(trifluoromethoxy)phenyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2-methylpropanoyl)-N-[3-(trifluoromethoxy)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 51937786 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (3S)-1-(2-methylpropanoyl)-N-[3-(trifluoromethoxy)phenyl]piperidine-3-carboxamide |
| SMILES | CC(C)C(=O)N1CCC[C@H](C(=O)Nc2cccc(OC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-11(2)16(24)22-8-4-5-12(10-22)15(23)21-13-6-3-7-14(9-13)25-17(18,19)20/h3,6-7,9,11-12H,4-5,8,10H2,1-2H3,(H,21,23)/t12-/m0/s1 |
| InChIKey | HGZVOTXXLNYVHG-LBPRGKRZSA-N |
| XLogP | 3.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |