C30H34N2O4 — CID 25223091
tert-butyl 3-[[3-[(4-phenylphenyl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 25223091) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl 3-[[3-[(4-phenylphenyl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[3-[(4-phenylphenyl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25223091 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tert-butyl 3-[[3-[(4-phenylphenyl)methoxy]phenyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)Nc2cccc(OCc3ccc(-c4ccccc4)cc3)c2)C1 |
| InChI | InChI=1S/C30H34N2O4/c1-30(2,3)36-29(34)32-18-8-11-25(20-32)28(33)31-26-12-7-13-27(19-26)35-21-22-14-16-24(17-15-22)23-9-5-4-6-10-23/h4-7,9-10,12-17,19,25H,8,11,18,20-21H2,1-3H3,(H,31,33) |
| InChIKey | KSPRGEDLPOISGT-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |