C17H28Cl3N3O2 — CID 119840505
7-amino-N-(3-chloro-2-morpholin-4-ylphenyl)heptanamide;dihydrochloride (PubChem CID 119840505) has the molecular formula C17H28Cl3N3O2 and a molecular weight of 412.79 g/mol. Its IUPAC name is 7-amino-N-(3-chloro-2-morpholin-4-ylphenyl)heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-(3-chloro-2-morpholin-4-ylphenyl)heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119840505 |
| Molecular Formula | C17H28Cl3N3O2 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 7-amino-N-(3-chloro-2-morpholin-4-ylphenyl)heptanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCCCCC(=O)Nc1cccc(Cl)c1N1CCOCC1 |
| InChI | InChI=1S/C17H26ClN3O2.2ClH/c18-14-6-5-7-15(17(14)21-10-12-23-13-11-21)20-16(22)8-3-1-2-4-9-19;;/h5-7H,1-4,8-13,19H2,(H,20,22);2*1H |
| InChIKey | VZWXQZKYWSVUHU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|