C22H25ClN2O3 — CID 41270500
N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide (PubChem CID 41270500) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide.
| Compound Name | N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 41270500 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2,5-dimethylphenyl)-4-oxobutanamide |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)Nc2cccc(Cl)c2N2CCOCC2)c1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-15-6-7-16(2)17(14-15)20(26)8-9-21(27)24-19-5-3-4-18(23)22(19)25-10-12-28-13-11-25/h3-7,14H,8-13H2,1-2H3,(H,24,27) |
| InChIKey | BBISKZGMFVMTHH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |