C22H27ClN2O4 — CID 41270735
N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2-ethoxyphenoxy)butanamide (PubChem CID 41270735) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2-ethoxyphenoxy)butanamide.
| Compound Name | N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2-ethoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 41270735 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-(3-chloro-2-morpholin-4-ylphenyl)-4-(2-ethoxyphenoxy)butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)Nc1cccc(Cl)c1N1CCOCC1 |
| InChI | InChI=1S/C22H27ClN2O4/c1-2-28-19-9-3-4-10-20(19)29-14-6-11-21(26)24-18-8-5-7-17(23)22(18)25-12-15-27-16-13-25/h3-5,7-10H,2,6,11-16H2,1H3,(H,24,26) |
| InChIKey | WBCRFUBLPXFYOO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|