C15H24Cl3N3O3 — CID 120595047
4-amino-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methoxybutanamide;dihydrochloride (PubChem CID 120595047) has the molecular formula C15H24Cl3N3O3 and a molecular weight of 400.73 g/mol. Its IUPAC name is 4-amino-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methoxybutanamide;dihydrochloride.
| Compound Name | 4-amino-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methoxybutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595047 |
| Molecular Formula | C15H24Cl3N3O3 |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 4-amino-N-(3-chloro-2-morpholin-4-ylphenyl)-3-methoxybutanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)Nc1cccc(Cl)c1N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C15H22ClN3O3.2ClH/c1-21-11(10-17)9-14(20)18-13-4-2-3-12(16)15(13)19-5-7-22-8-6-19;;/h2-4,11H,5-10,17H2,1H3,(H,18,20);2*1H |
| InChIKey | OWBLIHLUZVPRTC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |