C19H19ClF2N2O3 — CID 30461638
N-(3-chloro-2-morpholin-4-ylphenyl)-2-[4-(difluoromethoxy)phenyl]acetamide (PubChem CID 30461638) has the molecular formula C19H19ClF2N2O3 and a molecular weight of 396.82 g/mol. Its IUPAC name is N-(3-chloro-2-morpholin-4-ylphenyl)-2-[4-(difluoromethoxy)phenyl]acetamide.
| Compound Name | N-(3-chloro-2-morpholin-4-ylphenyl)-2-[4-(difluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 30461638 |
| Molecular Formula | C19H19ClF2N2O3 |
| Molecular Weight | 396.82 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | N-(3-chloro-2-morpholin-4-ylphenyl)-2-[4-(difluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(OC(F)F)cc1)Nc1cccc(Cl)c1N1CCOCC1 |
| InChI | InChI=1S/C19H19ClF2N2O3/c20-15-2-1-3-16(18(15)24-8-10-26-11-9-24)23-17(25)12-13-4-6-14(7-5-13)27-19(21)22/h1-7,19H,8-12H2,(H,23,25) |
| InChIKey | JNXOYXVMJNVXIK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |