C16H17ClN2O2S — CID 18141754
N-(3-chloro-2-morpholin-4-ylphenyl)-2-thiophen-3-ylacetamide (PubChem CID 18141754) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is N-(3-chloro-2-morpholin-4-ylphenyl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(3-chloro-2-morpholin-4-ylphenyl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 18141754 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | N-(3-chloro-2-morpholin-4-ylphenyl)-2-thiophen-3-ylacetamide |
| SMILES | O=C(Cc1ccsc1)Nc1cccc(Cl)c1N1CCOCC1 |
| InChI | InChI=1S/C16H17ClN2O2S/c17-13-2-1-3-14(16(13)19-5-7-21-8-6-19)18-15(20)10-12-4-9-22-11-12/h1-4,9,11H,5-8,10H2,(H,18,20) |
| InChIKey | JEWBQHHSZWCTAE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |