C17H28Cl2N4O4 — CID 120595053
4-amino-3-methoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide;dihydrochloride (PubChem CID 120595053) has the molecular formula C17H28Cl2N4O4 and a molecular weight of 423.34 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 120595053 |
| Molecular Formula | C17H28Cl2N4O4 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 4-amino-3-methoxy-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide;dihydrochloride |
| SMILES | COC(CN)CC(=O)Nc1ccc(NC(=O)CN2CCOCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C17H26N4O4.2ClH/c1-24-15(11-18)10-16(22)19-13-2-4-14(5-3-13)20-17(23)12-21-6-8-25-9-7-21;;/h2-5,15H,6-12,18H2,1H3,(H,19,22)(H,20,23);2*1H |
| InChIKey | AELCRFLCDGZWET-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |