C13H22Cl2N4O2 — CID 119845870
4-amino-N-(2-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride (PubChem CID 119845870) has the molecular formula C13H22Cl2N4O2 and a molecular weight of 337.25 g/mol. Its IUPAC name is 4-amino-N-(2-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride.
| Compound Name | 4-amino-N-(2-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119845870 |
| Molecular Formula | C13H22Cl2N4O2 |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-amino-N-(2-morpholin-4-yl-3-pyridinyl)butanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)Nc1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C13H20N4O2.2ClH/c14-5-1-4-12(18)16-11-3-2-6-15-13(11)17-7-9-19-10-8-17;;/h2-3,6H,1,4-5,7-10,14H2,(H,16,18);2*1H |
| InChIKey | DVKAXDZKHPIFAL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |