C14H24Cl2N4O2 — CID 119845832
2-amino-N-(2-morpholin-4-yl-3-pyridinyl)pentanamide;dihydrochloride (PubChem CID 119845832) has the molecular formula C14H24Cl2N4O2 and a molecular weight of 351.28 g/mol. Its IUPAC name is 2-amino-N-(2-morpholin-4-yl-3-pyridinyl)pentanamide;dihydrochloride.
| Compound Name | 2-amino-N-(2-morpholin-4-yl-3-pyridinyl)pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 119845832 |
| Molecular Formula | C14H24Cl2N4O2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-amino-N-(2-morpholin-4-yl-3-pyridinyl)pentanamide;dihydrochloride |
| SMILES | CCCC(N)C(=O)Nc1cccnc1N1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C14H22N4O2.2ClH/c1-2-4-11(15)14(19)17-12-5-3-6-16-13(12)18-7-9-20-10-8-18;;/h3,5-6,11H,2,4,7-10,15H2,1H3,(H,17,19);2*1H |
| InChIKey | SVLOQZWEDVPIQC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |