C15H22N4O4 — CID 122077569
2-methyl-3-[methyl-[(2-morpholin-4-yl-3-pyridinyl)carbamoyl]amino]propanoic acid (PubChem CID 122077569) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[(2-morpholin-4-yl-3-pyridinyl)carbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[(2-morpholin-4-yl-3-pyridinyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122077569 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-methyl-3-[methyl-[(2-morpholin-4-yl-3-pyridinyl)carbamoyl]amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)Nc1cccnc1N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C15H22N4O4/c1-11(14(20)21)10-18(2)15(22)17-12-4-3-5-16-13(12)19-6-8-23-9-7-19/h3-5,11H,6-10H2,1-2H3,(H,17,22)(H,20,21) |
| InChIKey | JJYSIFIREIOKAY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |