C18H19N3O4 — CID 75405128
2-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-yl-3-pyridinyl)acetamide (PubChem CID 75405128) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-yl-3-pyridinyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-yl-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 75405128 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(2-morpholin-4-yl-3-pyridinyl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)Nc1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C18H19N3O4/c22-17(11-13-3-4-15-16(10-13)25-12-24-15)20-14-2-1-5-19-18(14)21-6-8-23-9-7-21/h1-5,10H,6-9,11-12H2,(H,20,22) |
| InChIKey | FBKDSVJKNZKCBL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |