C15H22N4O2 — CID 119845865
N-(2-morpholin-4-yl-3-pyridinyl)-2-pyrrolidin-2-ylacetamide (PubChem CID 119845865) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-3-pyridinyl)-2-pyrrolidin-2-ylacetamide.
| Compound Name | N-(2-morpholin-4-yl-3-pyridinyl)-2-pyrrolidin-2-ylacetamide |
|---|---|
| PubChem CID | 119845865 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-(2-morpholin-4-yl-3-pyridinyl)-2-pyrrolidin-2-ylacetamide |
| SMILES | O=C(CC1CCCN1)Nc1cccnc1N1CCOCC1 |
| InChI | InChI=1S/C15H22N4O2/c20-14(11-12-3-1-5-16-12)18-13-4-2-6-17-15(13)19-7-9-21-10-8-19/h2,4,6,12,16H,1,3,5,7-11H2,(H,18,20) |
| InChIKey | KUERZINVKHEREF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |