C18H28N4O3 — CID 119900958
4-amino-N-(2,4-dimorpholin-4-ylphenyl)butanamide (PubChem CID 119900958) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is 4-amino-N-(2,4-dimorpholin-4-ylphenyl)butanamide.
| Compound Name | 4-amino-N-(2,4-dimorpholin-4-ylphenyl)butanamide |
|---|---|
| PubChem CID | 119900958 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 4-amino-N-(2,4-dimorpholin-4-ylphenyl)butanamide |
| SMILES | NCCCC(=O)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C18H28N4O3/c19-5-1-2-18(23)20-16-4-3-15(21-6-10-24-11-7-21)14-17(16)22-8-12-25-13-9-22/h3-4,14H,1-2,5-13,19H2,(H,20,23) |
| InChIKey | PQSXXOSDUHFCMD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |