C22H33N3O3S2 — CID 24648058
N-(2,4-dimorpholin-4-ylphenyl)-5-(dithiolan-3-yl)pentanamide (PubChem CID 24648058) has the molecular formula C22H33N3O3S2 and a molecular weight of 451.66 g/mol. Its IUPAC name is N-(2,4-dimorpholin-4-ylphenyl)-5-(dithiolan-3-yl)pentanamide.
| Compound Name | N-(2,4-dimorpholin-4-ylphenyl)-5-(dithiolan-3-yl)pentanamide |
|---|---|
| PubChem CID | 24648058 |
| Molecular Formula | C22H33N3O3S2 |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | N-(2,4-dimorpholin-4-ylphenyl)-5-(dithiolan-3-yl)pentanamide |
| SMILES | O=C(CCCCC1CCSS1)Nc1ccc(N2CCOCC2)cc1N1CCOCC1 |
| InChI | InChI=1S/C22H33N3O3S2/c26-22(4-2-1-3-19-7-16-29-30-19)23-20-6-5-18(24-8-12-27-13-9-24)17-21(20)25-10-14-28-15-11-25/h5-6,17,19H,1-4,7-16H2,(H,23,26) |
| InChIKey | UIEFCBLEOFNPRP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|